C14H14N2O5S — CID 168558825
2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]sulfanylacetic acid (PubChem CID 168558825) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 168558825 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1ccc(NC2=CC(=O)N(CCO)C2=O)cc1 |
| InChI | InChI=1S/C14H14N2O5S/c17-6-5-16-12(18)7-11(14(16)21)15-9-1-3-10(4-2-9)22-8-13(19)20/h1-4,7,15,17H,5-6,8H2,(H,19,20) |
| InChIKey | AFCIENUOCUPIQQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|