C31H26N2O3 — CID 168556758
1-(2-hydroxyethyl)-3-(4-tritylanilino)pyrrole-2,5-dione (PubChem CID 168556758) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(4-tritylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(4-tritylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556758 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(4-tritylanilino)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C31H26N2O3/c34-21-20-33-29(35)22-28(30(33)36)32-27-18-16-26(17-19-27)31(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,22,32,34H,20-21H2 |
| InChIKey | GEFUUJHULIUZSH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|