C12H11ClN2O3 — CID 16647775
3-(4-chloroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 16647775) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 3-(4-chloroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chloroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 16647775 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(4-chloroanilino)-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(Cl)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C12H11ClN2O3/c13-8-1-3-9(4-2-8)14-10-7-11(17)15(5-6-16)12(10)18/h1-4,7,14,16H,5-6H2 |
| InChIKey | DDUGZMYQXJLUSI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|