C13H13ClN2O4 — CID 168559789
3-[4-chloro-2-(hydroxymethyl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559789) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 3-[4-chloro-2-(hydroxymethyl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-chloro-2-(hydroxymethyl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559789 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[4-chloro-2-(hydroxymethyl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(Cl)cc2CO)C(=O)N1CCO |
| InChI | InChI=1S/C13H13ClN2O4/c14-9-1-2-10(8(5-9)7-18)15-11-6-12(19)16(3-4-17)13(11)20/h1-2,5-6,15,17-18H,3-4,7H2 |
| InChIKey | ZSTMYXNGERZNPD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|