C14H13FN2O5 — CID 168557775
[4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl] acetate (PubChem CID 168557775) has the molecular formula C14H13FN2O5 and a molecular weight of 308.26 g/mol. Its IUPAC name is [4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl] acetate.
| Compound Name | [4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 168557775 |
| Molecular Formula | C14H13FN2O5 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [4-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(F)c(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C14H13FN2O5/c1-8(19)22-9-2-3-10(15)11(6-9)16-12-7-13(20)17(4-5-18)14(12)21/h2-3,6-7,16,18H,4-5H2,1H3 |
| InChIKey | DQTLLCSENVAKKJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|