C15H15FN2O5 — CID 168557605
methyl 6-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate (PubChem CID 168557605) has the molecular formula C15H15FN2O5 and a molecular weight of 322.29 g/mol. Its IUPAC name is methyl 6-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate.
| Compound Name | methyl 6-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 168557605 |
| Molecular Formula | C15H15FN2O5 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | methyl 6-fluoro-3-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-methylbenzoate |
| SMILES | COC(=O)c1c(F)ccc(NC2=CC(=O)N(CCO)C2=O)c1C |
| InChI | InChI=1S/C15H15FN2O5/c1-8-10(4-3-9(16)13(8)15(22)23-2)17-11-7-12(20)18(5-6-19)14(11)21/h3-4,7,17,19H,5-6H2,1-2H3 |
| InChIKey | SEMDBWHRRQLJRA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|