C15H15IN2O5 — CID 168556196
methyl 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodo-4-methylbenzoate (PubChem CID 168556196) has the molecular formula C15H15IN2O5 and a molecular weight of 430.20 g/mol. Its IUPAC name is methyl 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodo-4-methylbenzoate.
| Compound Name | methyl 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodo-4-methylbenzoate |
|---|---|
| PubChem CID | 168556196 |
| Molecular Formula | C15H15IN2O5 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | methyl 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-5-iodo-4-methylbenzoate |
| SMILES | COC(=O)c1cc(I)c(C)cc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C15H15IN2O5/c1-8-5-11(9(6-10(8)16)15(22)23-2)17-12-7-13(20)18(3-4-19)14(12)21/h5-7,17,19H,3-4H2,1-2H3 |
| InChIKey | YJSVDNXXPRLBLL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|