C18H20N2O7 — CID 168557736
diethyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 168557736) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is diethyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 168557736 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | diethyl 4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(NC2=CC(=O)N(CCO)C2=O)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C18H20N2O7/c1-3-26-17(24)11-5-6-13(12(9-11)18(25)27-4-2)19-14-10-15(22)20(7-8-21)16(14)23/h5-6,9-10,19,21H,3-4,7-8H2,1-2H3 |
| InChIKey | UTGDZZLHDKKBPS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|