C15H16N4O7 — CID 168559946
ethyl N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-nitrophenyl]carbamate (PubChem CID 168559946) has the molecular formula C15H16N4O7 and a molecular weight of 364.31 g/mol. Its IUPAC name is ethyl N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-nitrophenyl]carbamate.
| Compound Name | ethyl N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 168559946 |
| Molecular Formula | C15H16N4O7 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | ethyl N-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-2-nitrophenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC2=CC(=O)N(CCO)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O7/c1-2-26-15(23)17-10-4-3-9(7-12(10)19(24)25)16-11-8-13(21)18(5-6-20)14(11)22/h3-4,7-8,16,20H,2,5-6H2,1H3,(H,17,23) |
| InChIKey | NMWBJZPCXHHWFK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|