C14H15N3O5 — CID 168558004
N-[2-hydroxy-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetamide (PubChem CID 168558004) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is N-[2-hydroxy-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-hydroxy-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 168558004 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[2-hydroxy-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC2=CC(=O)N(CCO)C2=O)ccc1O |
| InChI | InChI=1S/C14H15N3O5/c1-8(19)15-10-6-9(2-3-12(10)20)16-11-7-13(21)17(4-5-18)14(11)22/h2-3,6-7,16,18,20H,4-5H2,1H3,(H,15,19) |
| InChIKey | LZFVVRRMLGPMFX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|