C16H19N3O4 — CID 168557400
N-[2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]ethyl]acetamide (PubChem CID 168557400) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 168557400 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(NC2=CC(=O)N(CCO)C2=O)cc1 |
| InChI | InChI=1S/C16H19N3O4/c1-11(21)17-7-6-12-2-4-13(5-3-12)18-14-10-15(22)19(8-9-20)16(14)23/h2-5,10,18,20H,6-9H2,1H3,(H,17,21) |
| InChIKey | CWPPEOHIVLBIMX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|