C12H12N2O7S — CID 168558914
2-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonic acid (PubChem CID 168558914) has the molecular formula C12H12N2O7S and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonic acid.
| Compound Name | 2-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168558914 |
| Molecular Formula | C12H12N2O7S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-hydroxy-4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]benzenesulfonic acid |
| SMILES | O=C1C=C(Nc2ccc(S(=O)(=O)O)c(O)c2)C(=O)N1CCO |
| InChI | InChI=1S/C12H12N2O7S/c15-4-3-14-11(17)6-8(12(14)18)13-7-1-2-10(9(16)5-7)22(19,20)21/h1-2,5-6,13,15-16H,3-4H2,(H,19,20,21) |
| InChIKey | RUCHKYMGGZIYAB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|