C18H23N3O5S — CID 168557780
1-(2-hydroxyethyl)-3-(4-methylsulfonyl-3-piperidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 168557780) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(4-methylsulfonyl-3-piperidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(4-methylsulfonyl-3-piperidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557780 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(4-methylsulfonyl-3-piperidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | CS(=O)(=O)c1ccc(NC2=CC(=O)N(CCO)C2=O)cc1N1CCCCC1 |
| InChI | InChI=1S/C18H23N3O5S/c1-27(25,26)16-6-5-13(11-15(16)20-7-3-2-4-8-20)19-14-12-17(23)21(9-10-22)18(14)24/h5-6,11-12,19,22H,2-4,7-10H2,1H3 |
| InChIKey | AHIYTSQPPWEEED-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|