C19H25N3O5S — CID 168560047
1-(2-hydroxyethyl)-3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]pyrrole-2,5-dione (PubChem CID 168560047) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560047 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]pyrrole-2,5-dione |
| SMILES | CC1CCCN(c2ccc(S(C)(=O)=O)c(NC3=CC(=O)N(CCO)C3=O)c2)C1 |
| InChI | InChI=1S/C19H25N3O5S/c1-13-4-3-7-21(12-13)14-5-6-17(28(2,26)27)15(10-14)20-16-11-18(24)22(8-9-23)19(16)25/h5-6,10-11,13,20,23H,3-4,7-9,12H2,1-2H3 |
| InChIKey | HKXGTAIGPUPQKR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|