C14H21NO4S2 — CID 17408554
1-[2,4-bis(methylsulfonyl)phenyl]-3-methylpiperidine (PubChem CID 17408554) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-3-methylpiperidine.
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 17408554 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-3-methylpiperidine |
| SMILES | CC1CCCN(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H21NO4S2/c1-11-5-4-8-15(10-11)13-7-6-12(20(2,16)17)9-14(13)21(3,18)19/h6-7,9,11H,4-5,8,10H2,1-3H3 |
| InChIKey | BLFFYPIKRLRFJW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |