About 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine
1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine (PubChem CID 56797131) has the molecular formula C15H23NO4S2
and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine.
Molecular Properties
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine |
| PubChem CID | 56797131 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine |
| SMILES | CCC1CCN(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H23NO4S2/c1-4-12-7-9-16(10-8-12)14-6-5-13(21(2,17)18)11-15(14)22(3,19)20/h5-6,11-12H,4,7-10H2,1-3H3 |
| InChIKey | ZAKHOAUKKJKNTR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine?
The IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine (CID 56797131) is 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine.
What is the SMILES notation for 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine?
The canonical SMILES for 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine is CCC1CCN(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC1.
What is the InChIKey of 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine?
The InChIKey is ZAKHOAUKKJKNTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4S2/c1-4-12-7-9-16(10-8-12)14-6-5-13(21(2,17)18)11-15(14)22(3,19)20/h5-6,11-12H,4,7-10H2,1-3H3.
What are the key properties of 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine?
1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine has a molecular weight of 345.49 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(methylsulfonyl)phenyl]-4-ethylpiperidine is sourced from PubChem (CID 56797131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).