C21H28N2O4S2 — CID 56578839
4-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 56578839) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 56578839 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 4-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(CCC2CCN(c3ccc(S(N)(=O)=O)cc3S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O4S2/c1-16-3-5-17(6-4-16)7-8-18-11-13-23(14-12-18)20-10-9-19(29(22,26)27)15-21(20)28(2,24)25/h3-6,9-10,15,18H,7-8,11-14H2,1-2H3,(H2,22,26,27) |
| InChIKey | NIMMBGFBHUABFQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |