C16H23N3O5S2 — CID 56578586
N-cyclopropyl-1-(2-methylsulfonyl-4-sulfamoylphenyl)piperidine-3-carboxamide (PubChem CID 56578586) has the molecular formula C16H23N3O5S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-cyclopropyl-1-(2-methylsulfonyl-4-sulfamoylphenyl)piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-(2-methylsulfonyl-4-sulfamoylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56578586 |
| Molecular Formula | C16H23N3O5S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-cyclopropyl-1-(2-methylsulfonyl-4-sulfamoylphenyl)piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cc(S(N)(=O)=O)ccc1N1CCCC(C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C16H23N3O5S2/c1-25(21,22)15-9-13(26(17,23)24)6-7-14(15)19-8-2-3-11(10-19)16(20)18-12-4-5-12/h6-7,9,11-12H,2-5,8,10H2,1H3,(H,18,20)(H2,17,23,24) |
| InChIKey | WNQLIWOCFFOXSS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |