C15H23NO4S2 — CID 56800063
1-[2,4-bis(methylsulfonyl)phenyl]-4-methylazepane (PubChem CID 56800063) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-4-methylazepane.
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-4-methylazepane |
|---|---|
| PubChem CID | 56800063 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-4-methylazepane |
| SMILES | CC1CCCN(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H23NO4S2/c1-12-5-4-9-16(10-8-12)14-7-6-13(21(2,17)18)11-15(14)22(3,19)20/h6-7,11-12H,4-5,8-10H2,1-3H3 |
| InChIKey | WKXQCABXIIJBDP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |