C13H19NO5S2 — CID 22109063
1-[2,4-bis(methylsulfonyl)phenyl]piperidin-4-ol (PubChem CID 22109063) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]piperidin-4-ol.
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 22109063 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]piperidin-4-ol |
| SMILES | CS(=O)(=O)c1ccc(N2CCC(O)CC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H19NO5S2/c1-20(16,17)11-3-4-12(13(9-11)21(2,18)19)14-7-5-10(15)6-8-14/h3-4,9-10,15H,5-8H2,1-2H3 |
| InChIKey | QENGXVRXGCYAHB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |