C14H19BrN2O5S2 — CID 118513757
1-[4-[2,4-bis(methylsulfonyl)phenyl]piperazin-1-yl]-2-bromoethanone (PubChem CID 118513757) has the molecular formula C14H19BrN2O5S2 and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-[4-[2,4-bis(methylsulfonyl)phenyl]piperazin-1-yl]-2-bromoethanone.
| Compound Name | 1-[4-[2,4-bis(methylsulfonyl)phenyl]piperazin-1-yl]-2-bromoethanone |
|---|---|
| PubChem CID | 118513757 |
| Molecular Formula | C14H19BrN2O5S2 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 1-[4-[2,4-bis(methylsulfonyl)phenyl]piperazin-1-yl]-2-bromoethanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)CBr)CC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H19BrN2O5S2/c1-23(19,20)11-3-4-12(13(9-11)24(2,21)22)16-5-7-17(8-6-16)14(18)10-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | ARNCRVCRILVHIF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|