C18H21FN2O6S3 — CID 25329772
1-[2,4-bis(methylsulfonyl)phenyl]-4-(4-fluorophenyl)sulfonylpiperazine (PubChem CID 25329772) has the molecular formula C18H21FN2O6S3 and a molecular weight of 476.57 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-4-(4-fluorophenyl)sulfonylpiperazine.
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-4-(4-fluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 25329772 |
| Molecular Formula | C18H21FN2O6S3 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-4-(4-fluorophenyl)sulfonylpiperazine |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H21FN2O6S3/c1-28(22,23)16-7-8-17(18(13-16)29(2,24)25)20-9-11-21(12-10-20)30(26,27)15-5-3-14(19)4-6-15/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | KKKGFIOODFVKAK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |