C19H27N3O5S — CID 9277284
3-cyclopentyl-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]propan-1-one (PubChem CID 9277284) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-cyclopentyl-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 9277284 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-cyclopentyl-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]propan-1-one |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)CCC3CCCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H27N3O5S/c1-28(26,27)16-7-8-17(18(14-16)22(24)25)20-10-12-21(13-11-20)19(23)9-6-15-4-2-3-5-15/h7-8,14-15H,2-6,9-13H2,1H3 |
| InChIKey | MAPWZRUALOJGNH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|