C19H19Cl2N3O5S — CID 46469171
2-(3,4-dichlorophenyl)-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 46469171) has the molecular formula C19H19Cl2N3O5S and a molecular weight of 472.35 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46469171 |
| Molecular Formula | C19H19Cl2N3O5S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)Cc3ccc(Cl)c(Cl)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19Cl2N3O5S/c1-30(28,29)14-3-5-17(18(12-14)24(26)27)22-6-8-23(9-7-22)19(25)11-13-2-4-15(20)16(21)10-13/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | CHGBITMQXLVBRK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|