C16H22N4O5S — CID 119272566
[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone (PubChem CID 119272566) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is [4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone.
| Compound Name | [4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 119272566 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)C3CCCN3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22N4O5S/c1-26(24,25)12-4-5-14(15(11-12)20(22)23)18-7-9-19(10-8-18)16(21)13-3-2-6-17-13/h4-5,11,13,17H,2-3,6-10H2,1H3 |
| InChIKey | FSCPWSCKYPEEKR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|