C20H31N3O4S — CID 168515233
tert-butyl 4-(4-methylsulfonyl-2-pyrrolidin-1-ylphenyl)piperazine-1-carboxylate (PubChem CID 168515233) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is tert-butyl 4-(4-methylsulfonyl-2-pyrrolidin-1-ylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methylsulfonyl-2-pyrrolidin-1-ylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168515233 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | tert-butyl 4-(4-methylsulfonyl-2-pyrrolidin-1-ylphenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(S(C)(=O)=O)cc2N2CCCC2)CC1 |
| InChI | InChI=1S/C20H31N3O4S/c1-20(2,3)27-19(24)23-13-11-22(12-14-23)17-8-7-16(28(4,25)26)15-18(17)21-9-5-6-10-21/h7-8,15H,5-6,9-14H2,1-4H3 |
| InChIKey | UWCJRIIRLBLMAH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |