C15H21ClN2O3 — CID 155937830
tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperazine-1-carboxylate (PubChem CID 155937830) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155937830 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Cl)cc2O)CC1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-15(2,3)21-14(20)18-8-6-17(7-9-18)12-5-4-11(16)10-13(12)19/h4-5,10,19H,6-9H2,1-3H3 |
| InChIKey | MZZWMRAYDHIBAF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |