C16H20Cl2N2O3 — CID 162434268
tert-butyl 4-(4,5-dichloro-2-formylphenyl)piperazine-1-carboxylate (PubChem CID 162434268) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is tert-butyl 4-(4,5-dichloro-2-formylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4,5-dichloro-2-formylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162434268 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | tert-butyl 4-(4,5-dichloro-2-formylphenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(Cl)c(Cl)cc2C=O)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-16(2,3)23-15(22)20-6-4-19(5-7-20)14-9-13(18)12(17)8-11(14)10-21/h8-10H,4-7H2,1-3H3 |
| InChIKey | FVCQTZGFCLYPFM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|