C18H23N3O3 — CID 83972107
tert-butyl 4-(3-formyl-1H-indol-5-yl)piperazine-1-carboxylate (PubChem CID 83972107) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl 4-(3-formyl-1H-indol-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-formyl-1H-indol-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 83972107 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | tert-butyl 4-(3-formyl-1H-indol-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3[nH]cc(C=O)c3c2)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,3)24-17(23)21-8-6-20(7-9-21)14-4-5-16-15(10-14)13(12-22)11-19-16/h4-5,10-12,19H,6-9H2,1-3H3 |
| InChIKey | KUCXUOIDKDKTKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|