C14H21NO5S2 — CID 42926998
4-[2,4-bis(methylsulfonyl)phenyl]-2,6-dimethylmorpholine (PubChem CID 42926998) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[2,4-bis(methylsulfonyl)phenyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[2,4-bis(methylsulfonyl)phenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 42926998 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-[2,4-bis(methylsulfonyl)phenyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC(C)O1 |
| InChI | InChI=1S/C14H21NO5S2/c1-10-8-15(9-11(2)20-10)13-6-5-12(21(3,16)17)7-14(13)22(4,18)19/h5-7,10-11H,8-9H2,1-4H3 |
| InChIKey | RLIUPGWQIQPCPE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |