C13H21N3O3S — CID 103287518
5-amino-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-methylbenzenesulfonamide (PubChem CID 103287518) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-amino-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103287518 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-amino-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H21N3O3S/c1-9-7-16(8-10(2)19-9)12-5-4-11(14)6-13(12)20(17,18)15-3/h4-6,9-10,15H,7-8,14H2,1-3H3/t9-,10+ |
| InChIKey | XXQXWCIUTUNWAF-AOOOYVTPSA-N |
| XLogP | 0.79 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|