About 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide
5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide (PubChem CID 103286576) has the molecular formula C14H23N3O2S
and a molecular weight of 297.42 g/mol. Its IUPAC name is 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide |
| PubChem CID | 103286576 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H23N3O2S/c1-10-6-11(2)9-17(8-10)13-5-4-12(15)7-14(13)20(18,19)16-3/h4-5,7,10-11,16H,6,8-9,15H2,1-3H3 |
| InChIKey | IOMJCVHDUIUQLA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide?
The IUPAC name of 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide (CID 103286576) is 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide.
What is the SMILES notation for 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide?
The canonical SMILES for 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide is CNS(=O)(=O)c1cc(N)ccc1N1CC(C)CC(C)C1.
What is the InChIKey of 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide?
The InChIKey is IOMJCVHDUIUQLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2S/c1-10-6-11(2)9-17(8-10)13-5-4-12(15)7-14(13)20(18,19)16-3/h4-5,7,10-11,16H,6,8-9,15H2,1-3H3.
What are the key properties of 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide?
5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide has a molecular weight of 297.42 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(3,5-dimethylpiperidin-1-yl)-N-methylbenzenesulfonamide is sourced from PubChem (CID 103286576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).