C11H18N4O2S — CID 103286986
5-amino-N-methyl-2-piperazin-1-ylbenzenesulfonamide (PubChem CID 103286986) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 5-amino-N-methyl-2-piperazin-1-ylbenzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-piperazin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 103286986 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-amino-N-methyl-2-piperazin-1-ylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1N1CCNCC1 |
| InChI | InChI=1S/C11H18N4O2S/c1-13-18(16,17)11-8-9(12)2-3-10(11)15-6-4-14-5-7-15/h2-3,8,13-14H,4-7,12H2,1H3 |
| InChIKey | ZAAFABVQNWHFLF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|