C19H29NO2 — CID 65142715
tert-butyl 4-[2-(4-methylphenyl)ethyl]piperidine-1-carboxylate (PubChem CID 65142715) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-methylphenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-methylphenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 65142715 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl 4-[2-(4-methylphenyl)ethyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(CCC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H29NO2/c1-15-5-7-16(8-6-15)9-10-17-11-13-20(14-12-17)18(21)22-19(2,3)4/h5-8,17H,9-14H2,1-4H3 |
| InChIKey | WBUQMBMWGGHBQX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |