C26H40N2O4 — CID 52544737
tert-butyl 4-[4-[2-(4-ethoxyphenyl)ethyl]piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 52544737) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(4-ethoxyphenyl)ethyl]piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(4-ethoxyphenyl)ethyl]piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 52544737 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | tert-butyl 4-[4-[2-(4-ethoxyphenyl)ethyl]piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CCOc1ccc(CCC2CCN(C(=O)C3CCN(C(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H40N2O4/c1-5-31-23-10-8-20(9-11-23)6-7-21-12-16-27(17-13-21)24(29)22-14-18-28(19-15-22)25(30)32-26(2,3)4/h8-11,21-22H,5-7,12-19H2,1-4H3 |
| InChIKey | HWDSKDBUSYGYDO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |