C20H27NO2 — CID 118525540
tert-butyl 4-[2-(4-ethynylphenyl)ethyl]piperidine-1-carboxylate (PubChem CID 118525540) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-ethynylphenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-ethynylphenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118525540 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl 4-[2-(4-ethynylphenyl)ethyl]piperidine-1-carboxylate |
| SMILES | C#Cc1ccc(CCC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H27NO2/c1-5-16-6-8-17(9-7-16)10-11-18-12-14-21(15-13-18)19(22)23-20(2,3)4/h1,6-9,18H,10-15H2,2-4H3 |
| InChIKey | DMRRNEKNLJBUBY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|