C20H31NO2S — CID 143388255
tert-butyl 4-[3-(4-methylsulfanylphenyl)propyl]piperidine-1-carboxylate (PubChem CID 143388255) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-methylsulfanylphenyl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-methylsulfanylphenyl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143388255 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl 4-[3-(4-methylsulfanylphenyl)propyl]piperidine-1-carboxylate |
| SMILES | CSc1ccc(CCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31NO2S/c1-20(2,3)23-19(22)21-14-12-17(13-15-21)7-5-6-16-8-10-18(24-4)11-9-16/h8-11,17H,5-7,12-15H2,1-4H3 |
| InChIKey | YZUWGUDKDZECCF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |