C19H27NO2S — CID 67082506
tert-butyl 4-[2-(4-methylsulfanylphenyl)ethenyl]piperidine-1-carboxylate (PubChem CID 67082506) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-methylsulfanylphenyl)ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-methylsulfanylphenyl)ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67082506 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | tert-butyl 4-[2-(4-methylsulfanylphenyl)ethenyl]piperidine-1-carboxylate |
| SMILES | CSc1ccc(C=CC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H27NO2S/c1-19(2,3)22-18(21)20-13-11-16(12-14-20)6-5-15-7-9-17(23-4)10-8-15/h5-10,16H,11-14H2,1-4H3 |
| InChIKey | ACLRRBLVVXOLEI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |