C21H28N2O3S — CID 139551713
tert-butyl 4-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienoyl]piperazine-1-carboxylate (PubChem CID 139551713) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is tert-butyl 4-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139551713 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl 4-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienoyl]piperazine-1-carboxylate |
| SMILES | CSc1ccc(/C=C/C=C/C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-21(2,3)26-20(25)23-15-13-22(14-16-23)19(24)8-6-5-7-17-9-11-18(27-4)12-10-17/h5-12H,13-16H2,1-4H3/b7-5+,8-6+ |
| InChIKey | XSNBYFSZSUHWDJ-KQQUZDAGSA-N |
| XLogP | 4.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|