C22H33NO2 — CID 59686322
tert-butyl 4-[(E)-2-(3-tert-butylphenyl)ethenyl]piperidine-1-carboxylate (PubChem CID 59686322) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is tert-butyl 4-[(E)-2-(3-tert-butylphenyl)ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-2-(3-tert-butylphenyl)ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59686322 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl 4-[(E)-2-(3-tert-butylphenyl)ethenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(/C=C/c2cccc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C22H33NO2/c1-21(2,3)19-9-7-8-18(16-19)11-10-17-12-14-23(15-13-17)20(24)25-22(4,5)6/h7-11,16-17H,12-15H2,1-6H3/b11-10+ |
| InChIKey | WQBBXPSOOWOKHJ-ZHACJKMWSA-N |
| XLogP | 5.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |