C34H37N3O2 — CID 66852973
tert-butyl 4-[(Z)-2-(1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate (PubChem CID 66852973) has the molecular formula C34H37N3O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-2-(1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-2-(1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66852973 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | tert-butyl 4-[(Z)-2-(1-tritylimidazol-4-yl)ethenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(/C=C\c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C34H37N3O2/c1-33(2,3)39-32(38)36-23-21-27(22-24-36)19-20-31-25-37(26-35-31)34(28-13-7-4-8-14-28,29-15-9-5-10-16-29)30-17-11-6-12-18-30/h4-20,25-27H,21-24H2,1-3H3/b20-19- |
| InChIKey | WYTDWIIPVXSGDU-VXPUYCOJSA-N |
| XLogP | 7.38 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|