C33H33N3O3 — CID 20872897
tert-butyl (3Z)-2-oxo-3-[(1-tritylimidazol-4-yl)methylidene]piperidine-1-carboxylate (PubChem CID 20872897) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is tert-butyl (3Z)-2-oxo-3-[(1-tritylimidazol-4-yl)methylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3Z)-2-oxo-3-[(1-tritylimidazol-4-yl)methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20872897 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | tert-butyl (3Z)-2-oxo-3-[(1-tritylimidazol-4-yl)methylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC/C(=C/c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)C1=O |
| InChI | InChI=1S/C33H33N3O3/c1-32(2,3)39-31(38)36-21-13-14-25(30(36)37)22-29-23-35(24-34-29)33(26-15-7-4-8-16-26,27-17-9-5-10-18-27)28-19-11-6-12-20-28/h4-12,15-20,22-24H,13-14,21H2,1-3H3/b25-22- |
| InChIKey | JAOUZLVHDVSQQI-LVWGJNHUSA-N |
| XLogP | 6.66 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|