C33H35N3O4 — CID 71223286
(2Z)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-tritylimidazol-4-yl)methylidene]pentanoic acid (PubChem CID 71223286) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is (2Z)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-tritylimidazol-4-yl)methylidene]pentanoic acid.
| Compound Name | (2Z)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-tritylimidazol-4-yl)methylidene]pentanoic acid |
|---|---|
| PubChem CID | 71223286 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | (2Z)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-tritylimidazol-4-yl)methylidene]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC/C(=C/c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C33H35N3O4/c1-32(2,3)40-31(39)34-21-13-14-25(30(37)38)22-29-23-36(24-35-29)33(26-15-7-4-8-16-26,27-17-9-5-10-18-27)28-19-11-6-12-20-28/h4-12,15-20,22-24H,13-14,21H2,1-3H3,(H,34,39)(H,37,38)/b25-22- |
| InChIKey | RBTZVCDPVBSCAI-LVWGJNHUSA-N |
| XLogP | 6.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|