C21H33N3O4 — CID 71222980
2-[[1-(4-methylcyclohexyl)imidazol-4-yl]methylidene]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 71222980) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[[1-(4-methylcyclohexyl)imidazol-4-yl]methylidene]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | 2-[[1-(4-methylcyclohexyl)imidazol-4-yl]methylidene]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 71222980 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 2-[[1-(4-methylcyclohexyl)imidazol-4-yl]methylidene]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC1CCC(n2cnc(C=C(CCCNC(=O)OC(C)(C)C)C(=O)O)c2)CC1 |
| InChI | InChI=1S/C21H33N3O4/c1-15-7-9-18(10-8-15)24-13-17(23-14-24)12-16(19(25)26)6-5-11-22-20(27)28-21(2,3)4/h12-15,18H,5-11H2,1-4H3,(H,22,27)(H,25,26) |
| InChIKey | RGBSDCINABELFL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|