C13H22N4O2 — CID 18969335
tert-butyl 4-(4-aminoimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 18969335) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 4-(4-aminoimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-aminoimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18969335 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | tert-butyl 4-(4-aminoimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cnc(N)c2)CC1 |
| InChI | InChI=1S/C13H22N4O2/c1-13(2,3)19-12(18)16-6-4-10(5-7-16)17-8-11(14)15-9-17/h8-10H,4-7,14H2,1-3H3 |
| InChIKey | SPEGFCTUSUAJKM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |