C15H22N6O2 — CID 11381565
tert-butyl 4-(2-aminopurin-9-yl)piperidine-1-carboxylate (PubChem CID 11381565) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is tert-butyl 4-(2-aminopurin-9-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-aminopurin-9-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11381565 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | tert-butyl 4-(2-aminopurin-9-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cnc3cnc(N)nc32)CC1 |
| InChI | InChI=1S/C15H22N6O2/c1-15(2,3)23-14(22)20-6-4-10(5-7-20)21-9-18-11-8-17-13(16)19-12(11)21/h8-10H,4-7H2,1-3H3,(H2,16,17,19) |
| InChIKey | VBPHOLZVNRRPHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |