C17H30N4O2 — CID 144686665
tert-butyl 4-(5,6-diamino-3-pyridinyl)piperidine-1-carboxylate;ethane (PubChem CID 144686665) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 4-(5,6-diamino-3-pyridinyl)piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(5,6-diamino-3-pyridinyl)piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144686665 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | tert-butyl 4-(5,6-diamino-3-pyridinyl)piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(c2cnc(N)c(N)c2)CC1 |
| InChI | InChI=1S/C15H24N4O2.C2H6/c1-15(2,3)21-14(20)19-6-4-10(5-7-19)11-8-12(16)13(17)18-9-11;1-2/h8-10H,4-7,16H2,1-3H3,(H2,17,18);1-2H3 |
| InChIKey | XAZSMEMFPYUCEM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |