C17H25N3O6 — CID 74892502
tert-butyl 4-(5-amino-2-pyridinyl)piperidine-1-carboxylate;oxalic acid (PubChem CID 74892502) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-2-pyridinyl)piperidine-1-carboxylate;oxalic acid.
| Compound Name | tert-butyl 4-(5-amino-2-pyridinyl)piperidine-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 74892502 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | tert-butyl 4-(5-amino-2-pyridinyl)piperidine-1-carboxylate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(N)cn2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H23N3O2.C2H2O4/c1-15(2,3)20-14(19)18-8-6-11(7-9-18)13-5-4-12(16)10-17-13;3-1(4)2(5)6/h4-5,10-11H,6-9,16H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SZXVRBCRQYQBLK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 143.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|