C26H32N4O2 — CID 118267766
tert-butyl 4-(5-amino-1-benzhydrylpyrazol-3-yl)piperidine-1-carboxylate (PubChem CID 118267766) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-1-benzhydrylpyrazol-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-amino-1-benzhydrylpyrazol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118267766 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | tert-butyl 4-(5-amino-1-benzhydrylpyrazol-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(N)n(C(c3ccccc3)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C26H32N4O2/c1-26(2,3)32-25(31)29-16-14-19(15-17-29)22-18-23(27)30(28-22)24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,18-19,24H,14-17,27H2,1-3H3 |
| InChIKey | RIUKDNIUQTVXHS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |