C11H17N3O2 — CID 11356513
tert-butyl 5-amino-3-cyclopropylpyrazole-1-carboxylate (PubChem CID 11356513) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is tert-butyl 5-amino-3-cyclopropylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-amino-3-cyclopropylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 11356513 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | tert-butyl 5-amino-3-cyclopropylpyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(C2CC2)cc1N |
| InChI | InChI=1S/C11H17N3O2/c1-11(2,3)16-10(15)14-9(12)6-8(13-14)7-4-5-7/h6-7H,4-5,12H2,1-3H3 |
| InChIKey | LIRVTXMQFQGLQV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |